What is the structure of isoamyl alcohol?
Isoamyl alcohol
| PubChem CID | 31260 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C5H12O or (CH3)2CHCH2CH2OH |
| Synonyms | Isoamyl alcohol 3-Methyl-1-butanol Isopentyl alcohol 3-Methylbutan-1-ol Isopentanol More… |
Is isoamyl alcohol soluble in water?
Product Identification
| Product Name | Isoamyl Alcohol |
|---|---|
| Odour | Pear drops, ester |
| Viscosity | 7.2mPas (at 21°C) |
| Solubility in water | 28g/L |
| Boiling Point | 131-132°C |
Is isopentyl alcohol the same as isoamyl alcohol?
Isoamyl alcohol or Isopentanol, also known as isopentyl alcohol or iso-amylalkohol, belongs to the class of organic compounds known as primary alcohols. Primary alcohols are compounds comprising the alcohol functional group, attached to a primary carbon, with the general structure RCOH (R=alkyl, aryl).
What is another name for isoamyl alcohol?
| IUPAC Name | 3-methylbutan-1-ol |
|---|---|
| Alternative Names | 3-Methyl-1-butanol Isopentyl alcohol Isopentanol 3-Methylbutan-1-ol 3-Methylbutanol |
| Molecular Formula | C5H12O |
| Molar Mass | 88.15 g/mol |
| InChI | InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
How is isoamyl alcohol made?
Isoamyl alcohol can be synthesized by condensation of isobutene and formaldehyde which produces isoprenol and hydrogenation. It is a colourless liquid of density 0.8247 g/cm3 (0 °C), boiling at 131.6 °C, slightly soluble in water, and easily dissolved in organic solvents.
What does isoamyl alcohol do in DNA extraction?
Isoamyl alcohol:
In the phenol-chloroform DNA extraction method, Isoamyl alcohol helps in reducing foaming between interphase. It prevents the emulsification of a solution. The liquid phase contains DNA and the organic phase contains lipid, proteins and other impurities.